Chiodectonic acid

Chiodectonic acid
Names
	IUPAC name 2-Acetyl-3,5,6,8-tetrahydroxy-7-methoxybenzo[f][1]benzofuran-4,9-dione
Identifiers
3D model (JSmol)	Interactive image;
ChEBI	CHEBI:144214 ;
PubChem CID	138756199;
	InChI InChI=1S/C15H10O9/c1-3(16)13-11(21)6-7(17)4-5(9(19)14(6)24-13)10(20)15(23-2)12(22)8(4)18/h17,19,21-22H,1-2H3 Key: ILUWXELFYCLFHQ-UHFFFAOYSA-N ;
	SMILES COC1=C(O)C(=O)c2c(c(O)c3oc(C(C)=O)c(O)c3c2O)C1=O;
Properties
Chemical formula	C15H10O8
Molar mass	318.237 g·mol−1
Appearance	Dark red rhombic plates
Melting point	294–296 °C (561–565 °F; 567–569 K)
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Chiodectonic acid is an organic compound in the structural class of chemicals known as anthraquinones. It occurs as a secondary metabolite in some lichens.