Uric acid

Uric acid

Names
Preferred IUPAC name 7,9-Dihydro-1H-purine-2,6,8(3H)-trione
Other names 2,6,8-Trioxypurine; 2,6,8-Trihydroxypurine; 2,6,8-Trioxopurine; 1H-Purine-2,6,8-trione
Identifiers
CAS Number	69-93-2 Y
3D model (JSmol)	lactam form: Interactive image intermediate form: Interactive image lactim form: Interactive image urate monoanion: Interactive image
3DMet	B00094
Beilstein Reference	156158
ChEBI	CHEBI:27226 N
ChEMBL	ChEMBL792 Y
ChemSpider	1142 Y
DrugBank	DB01696 Y
ECHA InfoCard	100.000.655
EC Number	200-720-7
IUPHAR/BPS	4731
KEGG	C00366 N
MeSH	Uric+Acid
PubChem CID	1175
UNII	268B43MJ25 Y
CompTox Dashboard (EPA)	DTXSID3042508
InChI InChI=1S/C5H4N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h5,12H,(H,9,10)(H,7,8,11) N Key: DZGSAURIFGGOJK-UHFFFAOYSA-N N
SMILES lactam form: O=C1Nc2nc(=O)nc2C(=O)N1 intermediate form: Oc0nc(O)nc1c0NC(=O)N1 lactim form: Oc0nc(O)nc1c0N=C(O)N1 urate monoanion: Oc0nc(O)nc1c0N=C([O-])N1
Properties
Chemical formula	C5H4N4O3
Molar mass	168.112 g·mol−1
Appearance	White crystals
Melting point	300 °C (572 °F; 573 K)
Solubility in water	6 mg/100 mL (at 20 °C)
log P	−1.107
Acidity (pKa)	5.6
Basicity (pKb)	8.4
Magnetic susceptibility (χ)	−6.62×10−5 cm3 mol−1
Thermochemistry
Heat capacity (C)	166.15 J K−1 mol−1 (at 24.0 °C)
Std molar entropy (S⦵298)	173.2 J K−1 mol−1
Std enthalpy of formation (ΔfH⦵298)	−619.69 to −617.93 kJ mol−1
Std enthalpy of combustion (ΔcH⦵298)	−1921.2 to −1919.56 kJ mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). N verify (what is YN ?) Infobox references

Uric acid is a heterocyclic compound of carbon, nitrogen, oxygen, and hydrogen with the formula C₅H₄N₄O₃. It forms ions and salts known as urates and acid urates, such as ammonium acid urate. Uric acid is a product of the metabolic breakdown of purine nucleotides, and it is a normal component of urine.^[1] High blood concentrations of uric acid can lead to gout and are associated with other medical conditions, including diabetes and the formation of ammonium acid urate kidney stones.